About 2-tert-butylphenol;toluene
2-tert-butylphenol;toluene (PubChem CID 175493501) has the molecular formula C17H22O
and a molecular weight of 242.36 g/mol. Its IUPAC name is 2-tert-butylphenol;toluene.
Molecular Properties
| Compound Name | 2-tert-butylphenol;toluene |
| PubChem CID | 175493501 |
| Molecular Formula | C17H22O |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 2-tert-butylphenol;toluene |
| SMILES | CC(C)(C)c1ccccc1O.Cc1ccccc1 |
| InChI | InChI=1S/C10H14O.C7H8/c1-10(2,3)8-6-4-5-7-9(8)11;1-7-5-3-2-4-6-7/h4-7,11H,1-3H3;2-6H,1H3 |
| InChIKey | HJROJTBHKPFUHV-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-tert-butylphenol;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butylphenol;toluene?
The IUPAC name of 2-tert-butylphenol;toluene (CID 175493501) is 2-tert-butylphenol;toluene.
What is the SMILES notation for 2-tert-butylphenol;toluene?
The canonical SMILES for 2-tert-butylphenol;toluene is CC(C)(C)c1ccccc1O.Cc1ccccc1.
What is the InChIKey of 2-tert-butylphenol;toluene?
The InChIKey is HJROJTBHKPFUHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O.C7H8/c1-10(2,3)8-6-4-5-7-9(8)11;1-7-5-3-2-4-6-7/h4-7,11H,1-3H3;2-6H,1H3.
What are the key properties of 2-tert-butylphenol;toluene?
2-tert-butylphenol;toluene has a molecular weight of 242.36 g/mol, XLogP of 4.68, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butylphenol;toluene is sourced from PubChem (CID 175493501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).