About acetic acid;6-tert-butylbicyclo[2.2.0]hexa-1(6),2,4-trien-2-ol
acetic acid;6-tert-butylbicyclo[2.2.0]hexa-1(6),2,4-trien-2-ol (PubChem CID 21199772) has the molecular formula C12H16O3
and a molecular weight of 208.26 g/mol. Its IUPAC name is acetic acid;6-tert-butylbicyclo[2.2.0]hexa-1(6),2,4-trien-2-ol.
Analyze acetic acid;6-tert-butylbicyclo[2.2.0]hexa-1(6),2,4-trien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;6-tert-butylbicyclo[2.2.0]hexa-1(6),2,4-trien-2-ol?
The IUPAC name of acetic acid;6-tert-butylbicyclo[2.2.0]hexa-1(6),2,4-trien-2-ol (CID 21199772) is acetic acid;6-tert-butylbicyclo[2.2.0]hexa-1(6),2,4-trien-2-ol.
What is the SMILES notation for acetic acid;6-tert-butylbicyclo[2.2.0]hexa-1(6),2,4-trien-2-ol?
The canonical SMILES for acetic acid;6-tert-butylbicyclo[2.2.0]hexa-1(6),2,4-trien-2-ol is CC(=O)O.CC(C)(C)c1cc2cc(O)c1-2.
What is the InChIKey of acetic acid;6-tert-butylbicyclo[2.2.0]hexa-1(6),2,4-trien-2-ol?
The InChIKey is QASZPSXMLOSZDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O.C2H4O2/c1-10(2,3)7-4-6-5-8(11)9(6)7;1-2(3)4/h4-5,11H,1-3H3;1H3,(H,3,4).
What are the key properties of acetic acid;6-tert-butylbicyclo[2.2.0]hexa-1(6),2,4-trien-2-ol?
acetic acid;6-tert-butylbicyclo[2.2.0]hexa-1(6),2,4-trien-2-ol has a molecular weight of 208.26 g/mol, XLogP of 2.76, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;6-tert-butylbicyclo[2.2.0]hexa-1(6),2,4-trien-2-ol is sourced from PubChem (CID 21199772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).