C21H26O3 — CID 10336510
2-(1,3-benzodioxol-5-yl)-3,5-ditert-butylphenol (PubChem CID 10336510) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-3,5-ditert-butylphenol.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-3,5-ditert-butylphenol |
|---|---|
| PubChem CID | 10336510 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-3,5-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(O)c(-c2ccc3c(c2)OCO3)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C21H26O3/c1-20(2,3)14-10-15(21(4,5)6)19(16(22)11-14)13-7-8-17-18(9-13)24-12-23-17/h7-11,22H,12H2,1-6H3 |
| InChIKey | CMMATXIPQWFADP-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |