methyl 2-[2-(1,3-benzodioxol-5-yl)-3,5-dihydroxyphenyl]acetate

C16H14O6 — CID 11208853

IUPACmethyl 2-[2-(1,3-benzodioxol-5-yl)-3,5-dihydroxyphenyl]acetate
SMILESCOC(=O)Cc1cc(O)cc(O)c1-c1ccc2c(c1)OCO2
InChIInChI=1S/C16H14O6/c1-20-15(19)6-10-4-11(17)7-12(18)16(10)9-2-3-13-14(5-9)22-8-21-13/h2-5,7,17-18H,6,8H2,1H3
InChIKeyYDIAHRMNRCWZOD-UHFFFAOYSA-N
MW302.28 g/mol
LogP2.21
Rot. Bonds3

About methyl 2-[2-(1,3-benzodioxol-5-yl)-3,5-dihydroxyphenyl]acetate

methyl 2-[2-(1,3-benzodioxol-5-yl)-3,5-dihydroxyphenyl]acetate (PubChem CID 11208853) has the molecular formula C16H14O6 and a molecular weight of 302.28 g/mol. Its IUPAC name is methyl 2-[2-(1,3-benzodioxol-5-yl)-3,5-dihydroxyphenyl]acetate.

Molecular Properties

Compound Namemethyl 2-[2-(1,3-benzodioxol-5-yl)-3,5-dihydroxyphenyl]acetate
PubChem CID11208853
Molecular FormulaC16H14O6
Molecular Weight302.28 g/mol
Exact Mass302.08
IUPAC Namemethyl 2-[2-(1,3-benzodioxol-5-yl)-3,5-dihydroxyphenyl]acetate
SMILESCOC(=O)Cc1cc(O)cc(O)c1-c1ccc2c(c1)OCO2
InChIInChI=1S/C16H14O6/c1-20-15(19)6-10-4-11(17)7-12(18)16(10)9-2-3-13-14(5-9)22-8-21-13/h2-5,7,17-18H,6,8H2,1H3
InChIKeyYDIAHRMNRCWZOD-UHFFFAOYSA-N
XLogP2.21
TPSA85.22 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500302.28
LogP ≤ 52.21
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Analyze methyl 2-[2-(1,3-benzodioxol-5-yl)-3,5-dihydroxyphenyl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[2-(1,3-benzodioxol-5-yl)-3,5-dihydroxyphenyl]acetate?
The IUPAC name of methyl 2-[2-(1,3-benzodioxol-5-yl)-3,5-dihydroxyphenyl]acetate (CID 11208853) is methyl 2-[2-(1,3-benzodioxol-5-yl)-3,5-dihydroxyphenyl]acetate.
What is the SMILES notation for methyl 2-[2-(1,3-benzodioxol-5-yl)-3,5-dihydroxyphenyl]acetate?
The canonical SMILES for methyl 2-[2-(1,3-benzodioxol-5-yl)-3,5-dihydroxyphenyl]acetate is COC(=O)Cc1cc(O)cc(O)c1-c1ccc2c(c1)OCO2.
What is the InChIKey of methyl 2-[2-(1,3-benzodioxol-5-yl)-3,5-dihydroxyphenyl]acetate?
The InChIKey is YDIAHRMNRCWZOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O6/c1-20-15(19)6-10-4-11(17)7-12(18)16(10)9-2-3-13-14(5-9)22-8-21-13/h2-5,7,17-18H,6,8H2,1H3.
What are the key properties of methyl 2-[2-(1,3-benzodioxol-5-yl)-3,5-dihydroxyphenyl]acetate?
methyl 2-[2-(1,3-benzodioxol-5-yl)-3,5-dihydroxyphenyl]acetate has a molecular weight of 302.28 g/mol, XLogP of 2.21, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-(1,3-benzodioxol-5-yl)-3,5-dihydroxyphenyl]acetate is sourced from PubChem (CID 11208853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).