C23H21NO7 — CID 134227136
5-(1,3-benzodioxol-5-yl)-N-[(2,4-dihydroxyphenyl)methyl]-2,4-dimethoxybenzamide (PubChem CID 134227136) has the molecular formula C23H21NO7 and a molecular weight of 423.42 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-N-[(2,4-dihydroxyphenyl)methyl]-2,4-dimethoxybenzamide.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-N-[(2,4-dihydroxyphenyl)methyl]-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 134227136 |
| Molecular Formula | C23H21NO7 |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-N-[(2,4-dihydroxyphenyl)methyl]-2,4-dimethoxybenzamide |
| SMILES | COc1cc(OC)c(-c2ccc3c(c2)OCO3)cc1C(=O)NCc1ccc(O)cc1O |
| InChI | InChI=1S/C23H21NO7/c1-28-20-10-21(29-2)17(23(27)24-11-14-3-5-15(25)8-18(14)26)9-16(20)13-4-6-19-22(7-13)31-12-30-19/h3-10,25-26H,11-12H2,1-2H3,(H,24,27) |
| InChIKey | RDTUKDHLRHBKAK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|