C20H14O5 — CID 162666599
[4-(1,3-benzodioxol-5-yl)-3,5-dihydroxyphenyl]-phenylmethanone (PubChem CID 162666599) has the molecular formula C20H14O5 and a molecular weight of 334.33 g/mol. Its IUPAC name is [4-(1,3-benzodioxol-5-yl)-3,5-dihydroxyphenyl]-phenylmethanone.
| Compound Name | [4-(1,3-benzodioxol-5-yl)-3,5-dihydroxyphenyl]-phenylmethanone |
|---|---|
| PubChem CID | 162666599 |
| Molecular Formula | C20H14O5 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | [4-(1,3-benzodioxol-5-yl)-3,5-dihydroxyphenyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1cc(O)c(-c2ccc3c(c2)OCO3)c(O)c1 |
| InChI | InChI=1S/C20H14O5/c21-15-8-14(20(23)12-4-2-1-3-5-12)9-16(22)19(15)13-6-7-17-18(10-13)25-11-24-17/h1-10,21-22H,11H2 |
| InChIKey | GREFYUBKAWENIM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |