C16H11NO5 — CID 123899867
3-(1,3-benzodioxol-5-yl)-1-hydroxyindole-2-carboxylic acid (PubChem CID 123899867) has the molecular formula C16H11NO5 and a molecular weight of 297.27 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-1-hydroxyindole-2-carboxylic acid.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-1-hydroxyindole-2-carboxylic acid |
|---|---|
| PubChem CID | 123899867 |
| Molecular Formula | C16H11NO5 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-1-hydroxyindole-2-carboxylic acid |
| SMILES | O=C(O)c1c(-c2ccc3c(c2)OCO3)c2ccccc2n1O |
| InChI | InChI=1S/C16H11NO5/c18-16(19)15-14(10-3-1-2-4-11(10)17(15)20)9-5-6-12-13(7-9)22-8-21-12/h1-7,20H,8H2,(H,18,19) |
| InChIKey | MRPCODCSTMZPPD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|