C24H18N2O5 — CID 23060750
6-amino-2-(1,3-benzodioxol-5-ylmethyl)-1-oxo-4-phenylisoquinoline-3-carboxylic acid (PubChem CID 23060750) has the molecular formula C24H18N2O5 and a molecular weight of 414.42 g/mol. Its IUPAC name is 6-amino-2-(1,3-benzodioxol-5-ylmethyl)-1-oxo-4-phenylisoquinoline-3-carboxylic acid.
| Compound Name | 6-amino-2-(1,3-benzodioxol-5-ylmethyl)-1-oxo-4-phenylisoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 23060750 |
| Molecular Formula | C24H18N2O5 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 6-amino-2-(1,3-benzodioxol-5-ylmethyl)-1-oxo-4-phenylisoquinoline-3-carboxylic acid |
| SMILES | Nc1ccc2c(=O)n(Cc3ccc4c(c3)OCO4)c(C(=O)O)c(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C24H18N2O5/c25-16-7-8-17-18(11-16)21(15-4-2-1-3-5-15)22(24(28)29)26(23(17)27)12-14-6-9-19-20(10-14)31-13-30-19/h1-11H,12-13,25H2,(H,28,29) |
| InChIKey | UBZNBBRFGCFQOW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|