C26H18BrNO5 — CID 86599556
2-[2-(1,3-benzodioxol-5-ylmethyl)-6-bromo-1-oxo-4-phenylisoquinolin-3-yl]prop-2-enoic acid (PubChem CID 86599556) has the molecular formula C26H18BrNO5 and a molecular weight of 504.34 g/mol. Its IUPAC name is 2-[2-(1,3-benzodioxol-5-ylmethyl)-6-bromo-1-oxo-4-phenylisoquinolin-3-yl]prop-2-enoic acid.
| Compound Name | 2-[2-(1,3-benzodioxol-5-ylmethyl)-6-bromo-1-oxo-4-phenylisoquinolin-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 86599556 |
| Molecular Formula | C26H18BrNO5 |
| Molecular Weight | 504.34 g/mol |
| Exact Mass | 503.04 |
| IUPAC Name | 2-[2-(1,3-benzodioxol-5-ylmethyl)-6-bromo-1-oxo-4-phenylisoquinolin-3-yl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)c1c(-c2ccccc2)c2cc(Br)ccc2c(=O)n1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C26H18BrNO5/c1-15(26(30)31)24-23(17-5-3-2-4-6-17)20-12-18(27)8-9-19(20)25(29)28(24)13-16-7-10-21-22(11-16)33-14-32-21/h2-12H,1,13-14H2,(H,30,31) |
| InChIKey | DZJKRNGWGGMGCH-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.34 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|