C24H19N5O3 — CID 10180746
2-amino-3-(1,3-benzodioxol-5-ylmethyl)-7-(naphthalen-2-ylmethyl)purin-6-one (PubChem CID 10180746) has the molecular formula C24H19N5O3 and a molecular weight of 425.45 g/mol. Its IUPAC name is 2-amino-3-(1,3-benzodioxol-5-ylmethyl)-7-(naphthalen-2-ylmethyl)purin-6-one.
| Compound Name | 2-amino-3-(1,3-benzodioxol-5-ylmethyl)-7-(naphthalen-2-ylmethyl)purin-6-one |
|---|---|
| PubChem CID | 10180746 |
| Molecular Formula | C24H19N5O3 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 2-amino-3-(1,3-benzodioxol-5-ylmethyl)-7-(naphthalen-2-ylmethyl)purin-6-one |
| SMILES | Nc1nc(=O)c2c(ncn2Cc2ccc3ccccc3c2)n1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H19N5O3/c25-24-27-23(30)21-22(29(24)12-16-6-8-19-20(10-16)32-14-31-19)26-13-28(21)11-15-5-7-17-3-1-2-4-18(17)9-15/h1-10,13H,11-12,14H2,(H2,25,27,30) |
| InChIKey | WQOMNLAVBAXBSN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |