C32H23N5O3 — CID 70245654
2-[1-[2-amino-7-(naphthalen-2-ylmethyl)-6-oxopurin-3-yl]ethyl]anthracene-9,10-dione (PubChem CID 70245654) has the molecular formula C32H23N5O3 and a molecular weight of 525.57 g/mol. Its IUPAC name is 2-[1-[2-amino-7-(naphthalen-2-ylmethyl)-6-oxopurin-3-yl]ethyl]anthracene-9,10-dione.
| Compound Name | 2-[1-[2-amino-7-(naphthalen-2-ylmethyl)-6-oxopurin-3-yl]ethyl]anthracene-9,10-dione |
|---|---|
| PubChem CID | 70245654 |
| Molecular Formula | C32H23N5O3 |
| Molecular Weight | 525.57 g/mol |
| Exact Mass | 525.18 |
| IUPAC Name | 2-[1-[2-amino-7-(naphthalen-2-ylmethyl)-6-oxopurin-3-yl]ethyl]anthracene-9,10-dione |
| SMILES | CC(c1ccc2c(c1)C(=O)c1ccccc1C2=O)n1c(N)nc(=O)c2c1ncn2Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C32H23N5O3/c1-18(21-12-13-25-26(15-21)29(39)24-9-5-4-8-23(24)28(25)38)37-30-27(31(40)35-32(37)33)36(17-34-30)16-19-10-11-20-6-2-3-7-22(20)14-19/h2-15,17-18H,16H2,1H3,(H2,33,35,40) |
| InChIKey | AQXWYOGVCAEYDC-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 112.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.57 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|