C15H12O6S — CID 515141
2-[4-(1,3-benzodioxol-5-yl)phenyl]sulfonylacetic acid (PubChem CID 515141) has the molecular formula C15H12O6S and a molecular weight of 320.32 g/mol. Its IUPAC name is 2-[4-(1,3-benzodioxol-5-yl)phenyl]sulfonylacetic acid.
| Compound Name | 2-[4-(1,3-benzodioxol-5-yl)phenyl]sulfonylacetic acid |
|---|---|
| PubChem CID | 515141 |
| Molecular Formula | C15H12O6S |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 2-[4-(1,3-benzodioxol-5-yl)phenyl]sulfonylacetic acid |
| SMILES | O=C(O)CS(=O)(=O)c1ccc(-c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C15H12O6S/c16-15(17)8-22(18,19)12-4-1-10(2-5-12)11-3-6-13-14(7-11)21-9-20-13/h1-7H,8-9H2,(H,16,17) |
| InChIKey | BTWIKWLZLWUPEG-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |