C10H10O6S — CID 82020953
2-(1,3-benzodioxol-5-ylsulfonyl)propanoic acid (PubChem CID 82020953) has the molecular formula C10H10O6S and a molecular weight of 258.25 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylsulfonyl)propanoic acid.
| Compound Name | 2-(1,3-benzodioxol-5-ylsulfonyl)propanoic acid |
|---|---|
| PubChem CID | 82020953 |
| Molecular Formula | C10H10O6S |
| Molecular Weight | 258.25 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylsulfonyl)propanoic acid |
| SMILES | CC(C(=O)O)S(=O)(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C10H10O6S/c1-6(10(11)12)17(13,14)7-2-3-8-9(4-7)16-5-15-8/h2-4,6H,5H2,1H3,(H,11,12) |
| InChIKey | FGEBMHDGJSYUDC-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.25 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |