C17H19NO5S — CID 91511303
N-benzyl-N-[(2R)-1-hydroxypropan-2-yl]-1,3-benzodioxole-5-sulfonamide (PubChem CID 91511303) has the molecular formula C17H19NO5S and a molecular weight of 349.41 g/mol. Its IUPAC name is N-benzyl-N-[(2R)-1-hydroxypropan-2-yl]-1,3-benzodioxole-5-sulfonamide.
| Compound Name | N-benzyl-N-[(2R)-1-hydroxypropan-2-yl]-1,3-benzodioxole-5-sulfonamide |
|---|---|
| PubChem CID | 91511303 |
| Molecular Formula | C17H19NO5S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | N-benzyl-N-[(2R)-1-hydroxypropan-2-yl]-1,3-benzodioxole-5-sulfonamide |
| SMILES | C[C@H](CO)N(Cc1ccccc1)S(=O)(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H19NO5S/c1-13(11-19)18(10-14-5-3-2-4-6-14)24(20,21)15-7-8-16-17(9-15)23-12-22-16/h2-9,13,19H,10-12H2,1H3/t13-/m1/s1 |
| InChIKey | WBADOJUPWXVRQD-CYBMUJFWSA-N |
| XLogP | 1.99 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |