C13H9ClO3 — CID 39232296
4-(1,3-benzodioxol-5-yl)-2-chlorophenol (PubChem CID 39232296) has the molecular formula C13H9ClO3 and a molecular weight of 248.66 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-2-chlorophenol.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-2-chlorophenol |
|---|---|
| PubChem CID | 39232296 |
| Molecular Formula | C13H9ClO3 |
| Molecular Weight | 248.66 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-2-chlorophenol |
| SMILES | Oc1ccc(-c2ccc3c(c2)OCO3)cc1Cl |
| InChI | InChI=1S/C13H9ClO3/c14-10-5-8(1-3-11(10)15)9-2-4-12-13(6-9)17-7-16-12/h1-6,15H,7H2 |
| InChIKey | QHKHXRHSVGPMLE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.66 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |