C14H8Cl2O4 — CID 39233994
3-(1,3-benzodioxol-5-yl)-2,6-dichlorobenzoic acid (PubChem CID 39233994) has the molecular formula C14H8Cl2O4 and a molecular weight of 311.12 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-2,6-dichlorobenzoic acid.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-2,6-dichlorobenzoic acid |
|---|---|
| PubChem CID | 39233994 |
| Molecular Formula | C14H8Cl2O4 |
| Molecular Weight | 311.12 g/mol |
| Exact Mass | 309.98 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-2,6-dichlorobenzoic acid |
| SMILES | O=C(O)c1c(Cl)ccc(-c2ccc3c(c2)OCO3)c1Cl |
| InChI | InChI=1S/C14H8Cl2O4/c15-9-3-2-8(13(16)12(9)14(17)18)7-1-4-10-11(5-7)20-6-19-10/h1-5H,6H2,(H,17,18) |
| InChIKey | AMWSXZFCOQLCQS-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.12 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |