C92H142P4 — CID 102285718
CID 102285718 (PubChem CID 102285718) has the molecular formula C92H142P4 and a molecular weight of 1372.04 g/mol.
| Compound Name | CID 102285718 |
|---|---|
| PubChem CID | 102285718 |
| Molecular Formula | C92H142P4 |
| Molecular Weight | 1372.04 g/mol |
| Exact Mass | 1371.01 |
| IUPAC Name | — |
| SMILES | CCC(C)P1C(c2c(C(C)(C)C)cc(C(C)(C)C)cc2C(C)(C)C)=P(Cc2ccccc2CP2=C(c3c(C(C)(C)C)cc(C(C)(C)C)cc3C(C)(C)C)P(C(C)CC)C=2c2c(C(C)(C)C)cc(C(C)(C)C)cc2C(C)(C)C)=C1c1c(C(C)(C)C)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C92H142P4/c1-41-57(3)95-77(73-65(85(17,18)19)47-61(81(5,6)7)48-66(73)86(20,21)22)93(78(95)74-67(87(23,24)25)49-62(82(8,9)10)50-68(74)88(26,27)28)55-59-45-43-44-46-60(59)56-94-79(75-69(89(29,30)31)51-63(83(11,12)13)52-70(75)90(32,33)34)96(58(4)42-2)80(94)76-71(91(35,36)37)53-64(84(14,15)16)54-72(76)92(38,39)40/h43-54,57-58H,41-42,55-56H2,1-40H3 |
| InChIKey | HOGBCKUEOLROGJ-UHFFFAOYSA-N |
| XLogP | 28.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 96 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1372.04 |
| LogP ≤ 5 | 28.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|