C22H31NO — CID 86036245
2,4-ditert-butyl-6-(2-ethylanilino)phenol (PubChem CID 86036245) has the molecular formula C22H31NO and a molecular weight of 325.50 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-(2-ethylanilino)phenol.
| Compound Name | 2,4-ditert-butyl-6-(2-ethylanilino)phenol |
|---|---|
| PubChem CID | 86036245 |
| Molecular Formula | C22H31NO |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | 2,4-ditert-butyl-6-(2-ethylanilino)phenol |
| SMILES | CCc1ccccc1Nc1cc(C(C)(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C22H31NO/c1-8-15-11-9-10-12-18(15)23-19-14-16(21(2,3)4)13-17(20(19)24)22(5,6)7/h9-14,23-24H,8H2,1-7H3 |
| InChIKey | UJLZGUFPQXQWCN-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|