C40H52N2O2S — CID 102359329
2,4-ditert-butyl-6-[2-[2-(3,5-ditert-butyl-2-hydroxyanilino)phenyl]sulfanylanilino]phenol (PubChem CID 102359329) has the molecular formula C40H52N2O2S and a molecular weight of 624.94 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[2-[2-(3,5-ditert-butyl-2-hydroxyanilino)phenyl]sulfanylanilino]phenol.
| Compound Name | 2,4-ditert-butyl-6-[2-[2-(3,5-ditert-butyl-2-hydroxyanilino)phenyl]sulfanylanilino]phenol |
|---|---|
| PubChem CID | 102359329 |
| Molecular Formula | C40H52N2O2S |
| Molecular Weight | 624.94 g/mol |
| Exact Mass | 624.37 |
| IUPAC Name | 2,4-ditert-butyl-6-[2-[2-(3,5-ditert-butyl-2-hydroxyanilino)phenyl]sulfanylanilino]phenol |
| SMILES | CC(C)(C)c1cc(Nc2ccccc2Sc2ccccc2Nc2cc(C(C)(C)C)cc(C(C)(C)C)c2O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C40H52N2O2S/c1-37(2,3)25-21-27(39(7,8)9)35(43)31(23-25)41-29-17-13-15-19-33(29)45-34-20-16-14-18-30(34)42-32-24-26(38(4,5)6)22-28(36(32)44)40(10,11)12/h13-24,41-44H,1-12H3 |
| InChIKey | SCVNBSSQBYMTSD-UHFFFAOYSA-N |
| XLogP | 11.93 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.94 |
| LogP ≤ 5 | 11.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|