C20H26OS — CID 12058921
2,4-ditert-butyl-6-phenylsulfanylphenol (PubChem CID 12058921) has the molecular formula C20H26OS and a molecular weight of 314.49 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-phenylsulfanylphenol.
| Compound Name | 2,4-ditert-butyl-6-phenylsulfanylphenol |
|---|---|
| PubChem CID | 12058921 |
| Molecular Formula | C20H26OS |
| Molecular Weight | 314.49 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 2,4-ditert-butyl-6-phenylsulfanylphenol |
| SMILES | CC(C)(C)c1cc(Sc2ccccc2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C20H26OS/c1-19(2,3)14-12-16(20(4,5)6)18(21)17(13-14)22-15-10-8-7-9-11-15/h7-13,21H,1-6H3 |
| InChIKey | RLBDRVZELYGAEM-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.49 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |