C19H26OS — CID 102368359
2,4-ditert-butyl-6-cyclopenta-1,3-dien-1-ylsulfanylphenol (PubChem CID 102368359) has the molecular formula C19H26OS and a molecular weight of 302.48 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-cyclopenta-1,3-dien-1-ylsulfanylphenol.
| Compound Name | 2,4-ditert-butyl-6-cyclopenta-1,3-dien-1-ylsulfanylphenol |
|---|---|
| PubChem CID | 102368359 |
| Molecular Formula | C19H26OS |
| Molecular Weight | 302.48 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 2,4-ditert-butyl-6-cyclopenta-1,3-dien-1-ylsulfanylphenol |
| SMILES | CC(C)(C)c1cc(SC2=CC=CC2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H26OS/c1-18(2,3)13-11-15(19(4,5)6)17(20)16(12-13)21-14-9-7-8-10-14/h7-9,11-12,20H,10H2,1-6H3 |
| InChIKey | ABYUFCGVMUSJID-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.48 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |