C30H46Cl2O2S2Ti — CID 11192864
2,4-ditert-butyl-6-[2-(3,5-ditert-butyl-2-hydroxyphenyl)sulfanylethylsulfanyl]phenol;dichlorotitanium (PubChem CID 11192864) has the molecular formula C30H46Cl2O2S2Ti and a molecular weight of 621.60 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[2-(3,5-ditert-butyl-2-hydroxyphenyl)sulfanylethylsulfanyl]phenol;dichlorotitanium.
| Compound Name | 2,4-ditert-butyl-6-[2-(3,5-ditert-butyl-2-hydroxyphenyl)sulfanylethylsulfanyl]phenol;dichlorotitanium |
|---|---|
| PubChem CID | 11192864 |
| Molecular Formula | C30H46Cl2O2S2Ti |
| Molecular Weight | 621.60 g/mol |
| Exact Mass | 620.18 |
| IUPAC Name | 2,4-ditert-butyl-6-[2-(3,5-ditert-butyl-2-hydroxyphenyl)sulfanylethylsulfanyl]phenol;dichlorotitanium |
| SMILES | CC(C)(C)c1cc(SCCSc2cc(C(C)(C)C)cc(C(C)(C)C)c2O)c(O)c(C(C)(C)C)c1.Cl[Ti]Cl |
| InChI | InChI=1S/C30H46O2S2.2ClH.Ti/c1-27(2,3)19-15-21(29(7,8)9)25(31)23(17-19)33-13-14-34-24-18-20(28(4,5)6)16-22(26(24)32)30(10,11)12;;;/h15-18,31-32H,13-14H2,1-12H3;2*1H;/q;;;+2/p-2 |
| InChIKey | YBBBOEMTSLQFSZ-UHFFFAOYSA-L |
| XLogP | 10.55 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.60 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|