C22H32O2S2 — CID 174925209
2-tert-butyl-6-(3-tert-butyl-2-hydroxy-5-methylphenyl)sulfanyl-4-methylphenol;sulfane (PubChem CID 174925209) has the molecular formula C22H32O2S2 and a molecular weight of 392.63 g/mol. Its IUPAC name is 2-tert-butyl-6-(3-tert-butyl-2-hydroxy-5-methylphenyl)sulfanyl-4-methylphenol;sulfane.
| Compound Name | 2-tert-butyl-6-(3-tert-butyl-2-hydroxy-5-methylphenyl)sulfanyl-4-methylphenol;sulfane |
|---|---|
| PubChem CID | 174925209 |
| Molecular Formula | C22H32O2S2 |
| Molecular Weight | 392.63 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 2-tert-butyl-6-(3-tert-butyl-2-hydroxy-5-methylphenyl)sulfanyl-4-methylphenol;sulfane |
| SMILES | Cc1cc(Sc2cc(C)cc(C(C)(C)C)c2O)c(O)c(C(C)(C)C)c1.S |
| InChI | InChI=1S/C22H30O2S.H2S/c1-13-9-15(21(3,4)5)19(23)17(11-13)25-18-12-14(2)10-16(20(18)24)22(6,7)8;/h9-12,23-24H,1-8H3;1H2 |
| InChIKey | WYVBKYOPXGHGKL-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.63 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |