C20H24F2S — CID 153327256
1,4-ditert-butyl-2,3-difluoro-5-phenylsulfanylbenzene (PubChem CID 153327256) has the molecular formula C20H24F2S and a molecular weight of 334.48 g/mol. Its IUPAC name is 1,4-ditert-butyl-2,3-difluoro-5-phenylsulfanylbenzene.
| Compound Name | 1,4-ditert-butyl-2,3-difluoro-5-phenylsulfanylbenzene |
|---|---|
| PubChem CID | 153327256 |
| Molecular Formula | C20H24F2S |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 1,4-ditert-butyl-2,3-difluoro-5-phenylsulfanylbenzene |
| SMILES | CC(C)(C)c1cc(Sc2ccccc2)c(C(C)(C)C)c(F)c1F |
| InChI | InChI=1S/C20H24F2S/c1-19(2,3)14-12-15(23-13-10-8-7-9-11-13)16(20(4,5)6)18(22)17(14)21/h7-12H,1-6H3 |
| InChIKey | ULKXQALHBWVULN-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |