C21H27F3O3S2 — CID 162621988
1,2-ditert-butyl-3-phenylsulfanylbenzene;trifluoromethanesulfonic acid (PubChem CID 162621988) has the molecular formula C21H27F3O3S2 and a molecular weight of 448.57 g/mol. Its IUPAC name is 1,2-ditert-butyl-3-phenylsulfanylbenzene;trifluoromethanesulfonic acid.
| Compound Name | 1,2-ditert-butyl-3-phenylsulfanylbenzene;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 162621988 |
| Molecular Formula | C21H27F3O3S2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | 1,2-ditert-butyl-3-phenylsulfanylbenzene;trifluoromethanesulfonic acid |
| SMILES | CC(C)(C)c1cccc(Sc2ccccc2)c1C(C)(C)C.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C20H26S.CHF3O3S/c1-19(2,3)16-13-10-14-17(18(16)20(4,5)6)21-15-11-8-7-9-12-15;2-1(3,4)8(5,6)7/h7-14H,1-6H3;(H,5,6,7) |
| InChIKey | RXSHRPHXHCUOLI-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|