C23H22F6O3S2 — CID 171922932
1,1,2,2,3,3-hexafluorobutane-1-sulfonic acid;phenylsulfanylbenzene;toluene (PubChem CID 171922932) has the molecular formula C23H22F6O3S2 and a molecular weight of 524.55 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluorobutane-1-sulfonic acid;phenylsulfanylbenzene;toluene.
| Compound Name | 1,1,2,2,3,3-hexafluorobutane-1-sulfonic acid;phenylsulfanylbenzene;toluene |
|---|---|
| PubChem CID | 171922932 |
| Molecular Formula | C23H22F6O3S2 |
| Molecular Weight | 524.55 g/mol |
| Exact Mass | 524.09 |
| IUPAC Name | 1,1,2,2,3,3-hexafluorobutane-1-sulfonic acid;phenylsulfanylbenzene;toluene |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O.Cc1ccccc1.c1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10S.C7H8.C4H4F6O3S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-7-5-3-2-4-6-7;1-2(5,6)3(7,8)4(9,10)14(11,12)13/h1-10H;2-6H,1H3;1H3,(H,11,12,13) |
| InChIKey | BNHDEZZPCQDVDM-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.55 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|