C14H10F10O5S — CID 156636015
3,3,4,4,5,5,6,6,7,7-decafluoro-2-phenyl-2-sulfooctanoic acid (PubChem CID 156636015) has the molecular formula C14H10F10O5S and a molecular weight of 480.28 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7-decafluoro-2-phenyl-2-sulfooctanoic acid.
| Compound Name | 3,3,4,4,5,5,6,6,7,7-decafluoro-2-phenyl-2-sulfooctanoic acid |
|---|---|
| PubChem CID | 156636015 |
| Molecular Formula | C14H10F10O5S |
| Molecular Weight | 480.28 g/mol |
| Exact Mass | 480.01 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7-decafluoro-2-phenyl-2-sulfooctanoic acid |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(C(=O)O)(c1ccccc1)S(=O)(=O)O |
| InChI | InChI=1S/C14H10F10O5S/c1-9(15,16)11(17,18)13(21,22)14(23,24)12(19,20)10(8(25)26,30(27,28)29)7-5-3-2-4-6-7/h2-6H,1H3,(H,25,26)(H,27,28,29) |
| InChIKey | VCNBAORRTXKEEM-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.28 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|