C13H2F24O5S — CID 91283050
2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-tetracosafluoro-2-sulfotridecanoic acid (PubChem CID 91283050) has the molecular formula C13H2F24O5S and a molecular weight of 726.17 g/mol. Its IUPAC name is 2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-tetracosafluoro-2-sulfotridecanoic acid.
| Compound Name | 2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-tetracosafluoro-2-sulfotridecanoic acid |
|---|---|
| PubChem CID | 91283050 |
| Molecular Formula | C13H2F24O5S |
| Molecular Weight | 726.17 g/mol |
| Exact Mass | 725.92 |
| IUPAC Name | 2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-tetracosafluoro-2-sulfotridecanoic acid |
| SMILES | O=C(O)C(F)(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)S(=O)(=O)O |
| InChI | InChI=1S/C13H2F24O5S/c14-2(1(38)39,43(40,41)42)3(15,16)4(17,18)5(19,20)6(21,22)7(23,24)8(25,26)9(27,28)10(29,30)11(31,32)12(33,34)13(35,36)37/h(H,38,39)(H,40,41,42) |
| InChIKey | YADHOXLZJRWQCI-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.17 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|