C82H55F6O3PS — CID 162622536
1,1,2,2,3,3-hexafluorobutane-1-sulfonic acid;phenyl-bis(2,4,6-trinaphthalen-1-ylphenyl)phosphane (PubChem CID 162622536) has the molecular formula C82H55F6O3PS and a molecular weight of 1265.37 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluorobutane-1-sulfonic acid;phenyl-bis(2,4,6-trinaphthalen-1-ylphenyl)phosphane.
| Compound Name | 1,1,2,2,3,3-hexafluorobutane-1-sulfonic acid;phenyl-bis(2,4,6-trinaphthalen-1-ylphenyl)phosphane |
|---|---|
| PubChem CID | 162622536 |
| Molecular Formula | C82H55F6O3PS |
| Molecular Weight | 1265.37 g/mol |
| Exact Mass | 1264.35 |
| IUPAC Name | 1,1,2,2,3,3-hexafluorobutane-1-sulfonic acid;phenyl-bis(2,4,6-trinaphthalen-1-ylphenyl)phosphane |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O.c1ccc(P(c2c(-c3cccc4ccccc34)cc(-c3cccc4ccccc34)cc2-c2cccc3ccccc23)c2c(-c3cccc4ccccc34)cc(-c3cccc4ccccc34)cc2-c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C78H51P.C4H4F6O3S/c1-2-34-60(35-3-1)79(77-73(69-44-18-30-54-24-6-12-38-63(54)69)48-58(67-42-16-28-52-22-4-10-36-61(52)67)49-74(77)70-45-19-31-55-25-7-13-39-64(55)70)78-75(71-46-20-32-56-26-8-14-40-65(56)71)50-59(68-43-17-29-53-23-5-11-37-62(53)68)51-76(78)72-47-21-33-57-27-9-15-41-66(57)72;1-2(5,6)3(7,8)4(9,10)14(11,12)13/h1-51H;1H3,(H,11,12,13) |
| InChIKey | RPLDIEWOWCXRSZ-UHFFFAOYSA-N |
| XLogP | 22.12 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 93 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1265.37 |
| LogP ≤ 5 | 22.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|