C29H23F3O3S2 — CID 11049821
dimethyl-[3-(8-naphthalen-1-ylnaphthalen-1-yl)phenyl]sulfanium;trifluoromethanesulfonate (PubChem CID 11049821) has the molecular formula C29H23F3O3S2 and a molecular weight of 540.63 g/mol. Its IUPAC name is dimethyl-[3-(8-naphthalen-1-ylnaphthalen-1-yl)phenyl]sulfanium;trifluoromethanesulfonate.
| Compound Name | dimethyl-[3-(8-naphthalen-1-ylnaphthalen-1-yl)phenyl]sulfanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11049821 |
| Molecular Formula | C29H23F3O3S2 |
| Molecular Weight | 540.63 g/mol |
| Exact Mass | 540.10 |
| IUPAC Name | dimethyl-[3-(8-naphthalen-1-ylnaphthalen-1-yl)phenyl]sulfanium;trifluoromethanesulfonate |
| SMILES | C[S+](C)c1cccc(-c2cccc3cccc(-c4cccc5ccccc45)c23)c1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C28H23S.CHF3O3S/c1-29(2)23-14-5-13-22(19-23)25-16-7-11-21-12-8-18-27(28(21)25)26-17-6-10-20-9-3-4-15-24(20)26;2-1(3,4)8(5,6)7/h3-19H,1-2H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | SURWRORBBASBJU-UHFFFAOYSA-M |
| XLogP | 7.62 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.63 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|