C42H24F4O4S — CID 176603434
2,3,5,6-tetrafluoro-4-(2,4,6-trinaphthalen-1-ylphenoxy)benzenesulfonic acid (PubChem CID 176603434) has the molecular formula C42H24F4O4S and a molecular weight of 700.71 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-(2,4,6-trinaphthalen-1-ylphenoxy)benzenesulfonic acid.
| Compound Name | 2,3,5,6-tetrafluoro-4-(2,4,6-trinaphthalen-1-ylphenoxy)benzenesulfonic acid |
|---|---|
| PubChem CID | 176603434 |
| Molecular Formula | C42H24F4O4S |
| Molecular Weight | 700.71 g/mol |
| Exact Mass | 700.13 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-(2,4,6-trinaphthalen-1-ylphenoxy)benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1c(F)c(F)c(Oc2c(-c3cccc4ccccc34)cc(-c3cccc4ccccc34)cc2-c2cccc3ccccc23)c(F)c1F |
| InChI | InChI=1S/C42H24F4O4S/c43-36-38(45)42(51(47,48)49)39(46)37(44)41(36)50-40-34(32-20-8-14-25-11-2-5-17-29(25)32)22-27(31-19-7-13-24-10-1-4-16-28(24)31)23-35(40)33-21-9-15-26-12-3-6-18-30(26)33/h1-23H,(H,47,48,49) |
| InChIKey | NTVGLPUIUMUMTR-UHFFFAOYSA-N |
| XLogP | 11.74 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.71 |
| LogP ≤ 5 | 11.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|