About sulfurothioic O-acid;toluene
sulfurothioic O-acid;toluene (PubChem CID 174461013) has the molecular formula C14H18O3S2
and a molecular weight of 298.43 g/mol. Its IUPAC name is sulfurothioic O-acid;toluene.
Molecular Properties
| Compound Name | sulfurothioic O-acid;toluene |
| PubChem CID | 174461013 |
| Molecular Formula | C14H18O3S2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | sulfurothioic O-acid;toluene |
| SMILES | Cc1ccccc1.Cc1ccccc1.O=S(O)(O)=S |
| InChI | InChI=1S/2C7H8.H2O3S2/c2*1-7-5-3-2-4-6-7;1-5(2,3)4/h2*2-6H,1H3;(H2,1,2,3,4) |
| InChIKey | IFCNAGKHSCTUJW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sulfurothioic O-acid;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfurothioic O-acid;toluene?
The IUPAC name of sulfurothioic O-acid;toluene (CID 174461013) is sulfurothioic O-acid;toluene.
What is the SMILES notation for sulfurothioic O-acid;toluene?
The canonical SMILES for sulfurothioic O-acid;toluene is Cc1ccccc1.Cc1ccccc1.O=S(O)(O)=S.
What is the InChIKey of sulfurothioic O-acid;toluene?
The InChIKey is IFCNAGKHSCTUJW-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H8.H2O3S2/c2*1-7-5-3-2-4-6-7;1-5(2,3)4/h2*2-6H,1H3;(H2,1,2,3,4).
What are the key properties of sulfurothioic O-acid;toluene?
sulfurothioic O-acid;toluene has a molecular weight of 298.43 g/mol, XLogP of 3.67, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sulfurothioic O-acid;toluene is sourced from PubChem (CID 174461013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).