C27H31Cl3NOSTi — CID 135475785
2,4-ditert-butyl-6-[(2-phenylsulfanylphenyl)iminomethyl]phenol;trichlorotitanium (PubChem CID 135475785) has the molecular formula C27H31Cl3NOSTi and a molecular weight of 571.84 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[(2-phenylsulfanylphenyl)iminomethyl]phenol;trichlorotitanium.
| Compound Name | 2,4-ditert-butyl-6-[(2-phenylsulfanylphenyl)iminomethyl]phenol;trichlorotitanium |
|---|---|
| PubChem CID | 135475785 |
| Molecular Formula | C27H31Cl3NOSTi |
| Molecular Weight | 571.84 g/mol |
| Exact Mass | 570.07 |
| IUPAC Name | 2,4-ditert-butyl-6-[(2-phenylsulfanylphenyl)iminomethyl]phenol;trichlorotitanium |
| SMILES | CC(C)(C)c1cc(/C=N/c2ccccc2Sc2ccccc2)c(O)c(C(C)(C)C)c1.Cl[Ti](Cl)Cl |
| InChI | InChI=1S/C27H31NOS.3ClH.Ti/c1-26(2,3)20-16-19(25(29)22(17-20)27(4,5)6)18-28-23-14-10-11-15-24(23)30-21-12-8-7-9-13-21;;;;/h7-18,29H,1-6H3;3*1H;/q;;;;+3/p-3/b28-18+;;;; |
| InChIKey | ULNYECGUAABAMR-YDTFSKQCSA-K |
| XLogP | 9.95 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.84 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|