C27H31NOSi — CID 162278985
CID 162278985 (PubChem CID 162278985) has the molecular formula C27H31NOSi and a molecular weight of 413.64 g/mol.
| Compound Name | CID 162278985 |
|---|---|
| PubChem CID | 162278985 |
| Molecular Formula | C27H31NOSi |
| Molecular Weight | 413.64 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cc(/C=N/c2ccccc2[Si]c2ccccc2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C27H31NOSi/c1-26(2,3)20-16-19(25(29)22(17-20)27(4,5)6)18-28-23-14-10-11-15-24(23)30-21-12-8-7-9-13-21/h7-18,29H,1-6H3/b28-18+ |
| InChIKey | MHPPGTLGWYASDG-MTDXEUNCSA-N |
| XLogP | 5.39 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.64 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|