C28H29Cl3F4NO2Ti — CID 162285378
2,4-ditert-butyl-6-[[2-(2,3,4,6-tetrafluoro-5-methylphenoxy)phenyl]iminomethyl]phenol;trichlorotitanium (PubChem CID 162285378) has the molecular formula C28H29Cl3F4NO2Ti and a molecular weight of 641.76 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[[2-(2,3,4,6-tetrafluoro-5-methylphenoxy)phenyl]iminomethyl]phenol;trichlorotitanium.
| Compound Name | 2,4-ditert-butyl-6-[[2-(2,3,4,6-tetrafluoro-5-methylphenoxy)phenyl]iminomethyl]phenol;trichlorotitanium |
|---|---|
| PubChem CID | 162285378 |
| Molecular Formula | C28H29Cl3F4NO2Ti |
| Molecular Weight | 641.76 g/mol |
| Exact Mass | 640.07 |
| IUPAC Name | 2,4-ditert-butyl-6-[[2-(2,3,4,6-tetrafluoro-5-methylphenoxy)phenyl]iminomethyl]phenol;trichlorotitanium |
| SMILES | Cc1c(F)c(F)c(F)c(Oc2ccccc2/N=C/c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)c1F.Cl[Ti](Cl)Cl |
| InChI | InChI=1S/C28H29F4NO2.3ClH.Ti/c1-15-21(29)23(31)24(32)26(22(15)30)35-20-11-9-8-10-19(20)33-14-16-12-17(27(2,3)4)13-18(25(16)34)28(5,6)7;;;;/h8-14,34H,1-7H3;3*1H;/q;;;;+3/p-3/b33-14+;;;; |
| InChIKey | ICQYRMICGBJMEU-NNGCNBDDSA-K |
| XLogP | 10.46 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.76 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|