C36H28F5NO — CID 137234453
2-tert-butyl-6-[(2,3,4,5,6-pentafluorophenyl)iminomethyl]-4-tritylphenol (PubChem CID 137234453) has the molecular formula C36H28F5NO and a molecular weight of 585.62 g/mol. Its IUPAC name is 2-tert-butyl-6-[(2,3,4,5,6-pentafluorophenyl)iminomethyl]-4-tritylphenol.
| Compound Name | 2-tert-butyl-6-[(2,3,4,5,6-pentafluorophenyl)iminomethyl]-4-tritylphenol |
|---|---|
| PubChem CID | 137234453 |
| Molecular Formula | C36H28F5NO |
| Molecular Weight | 585.62 g/mol |
| Exact Mass | 585.21 |
| IUPAC Name | 2-tert-butyl-6-[(2,3,4,5,6-pentafluorophenyl)iminomethyl]-4-tritylphenol |
| SMILES | CC(C)(C)c1cc(C(c2ccccc2)(c2ccccc2)c2ccccc2)cc(/C=N/c2c(F)c(F)c(F)c(F)c2F)c1O |
| InChI | InChI=1S/C36H28F5NO/c1-35(2,3)27-20-26(19-22(34(27)43)21-42-33-31(40)29(38)28(37)30(39)32(33)41)36(23-13-7-4-8-14-23,24-15-9-5-10-16-24)25-17-11-6-12-18-25/h4-21,43H,1-3H3/b42-21+ |
| InChIKey | WCTNWYYMCUIGBK-BKPOFFDFSA-N |
| XLogP | 9.52 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.62 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|