C48H47NO — CID 137234465
2-[(2-cyclopentyl-4,6-dimethylphenyl)iminomethyl]-6-(2-phenylpropan-2-yl)-4-tritylphenol (PubChem CID 137234465) has the molecular formula C48H47NO and a molecular weight of 653.91 g/mol. Its IUPAC name is 2-[(2-cyclopentyl-4,6-dimethylphenyl)iminomethyl]-6-(2-phenylpropan-2-yl)-4-tritylphenol.
| Compound Name | 2-[(2-cyclopentyl-4,6-dimethylphenyl)iminomethyl]-6-(2-phenylpropan-2-yl)-4-tritylphenol |
|---|---|
| PubChem CID | 137234465 |
| Molecular Formula | C48H47NO |
| Molecular Weight | 653.91 g/mol |
| Exact Mass | 653.37 |
| IUPAC Name | 2-[(2-cyclopentyl-4,6-dimethylphenyl)iminomethyl]-6-(2-phenylpropan-2-yl)-4-tritylphenol |
| SMILES | Cc1cc(C)c(/N=C/c2cc(C(c3ccccc3)(c3ccccc3)c3ccccc3)cc(C(C)(C)c3ccccc3)c2O)c(C2CCCC2)c1 |
| InChI | InChI=1S/C48H47NO/c1-34-29-35(2)45(43(30-34)36-19-17-18-20-36)49-33-37-31-42(32-44(46(37)50)47(3,4)38-21-9-5-10-22-38)48(39-23-11-6-12-24-39,40-25-13-7-14-26-40)41-27-15-8-16-28-41/h5-16,21-33,36,50H,17-20H2,1-4H3/b49-33+ |
| InChIKey | XJXIKANVSXXUMP-WBTPITFISA-N |
| XLogP | 12.13 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.91 |
| LogP ≤ 5 | 12.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|