C66H66N2O2 — CID 137203959
4-tert-butyl-2-[[(1R,2R)-2-[(5-tert-butyl-2-hydroxy-3-tritylphenyl)methylideneamino]cyclohexyl]iminomethyl]-6-tritylphenol (PubChem CID 137203959) has the molecular formula C66H66N2O2 and a molecular weight of 919.27 g/mol. Its IUPAC name is 4-tert-butyl-2-[[(1R,2R)-2-[(5-tert-butyl-2-hydroxy-3-tritylphenyl)methylideneamino]cyclohexyl]iminomethyl]-6-tritylphenol.
| Compound Name | 4-tert-butyl-2-[[(1R,2R)-2-[(5-tert-butyl-2-hydroxy-3-tritylphenyl)methylideneamino]cyclohexyl]iminomethyl]-6-tritylphenol |
|---|---|
| PubChem CID | 137203959 |
| Molecular Formula | C66H66N2O2 |
| Molecular Weight | 919.27 g/mol |
| Exact Mass | 918.51 |
| IUPAC Name | 4-tert-butyl-2-[[(1R,2R)-2-[(5-tert-butyl-2-hydroxy-3-tritylphenyl)methylideneamino]cyclohexyl]iminomethyl]-6-tritylphenol |
| SMILES | CC(C)(C)c1cc(/C=N/[C@@H]2CCCC[C@H]2/N=C/c2cc(C(C)(C)C)cc(C(c3ccccc3)(c3ccccc3)c3ccccc3)c2O)c(O)c(C(c2ccccc2)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C66H66N2O2/c1-63(2,3)55-41-47(61(69)57(43-55)65(49-27-13-7-14-28-49,50-29-15-8-16-30-50)51-31-17-9-18-32-51)45-67-59-39-25-26-40-60(59)68-46-48-42-56(64(4,5)6)44-58(62(48)70)66(52-33-19-10-20-34-52,53-35-21-11-22-36-53)54-37-23-12-24-38-54/h7-24,27-38,41-46,59-60,69-70H,25-26,39-40H2,1-6H3/b67-45+,68-46+/t59-,60-/m1/s1 |
| InChIKey | JNBKLNJKZWCRFL-WJWPSONUSA-N |
| XLogP | 15.31 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 919.27 |
| LogP ≤ 5 | 15.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|