C40H46N2O2 — CID 137069260
4-tert-butyl-2-[[2-[(5-tert-butyl-2-hydroxy-3-phenylphenyl)methylideneamino]cyclohexyl]iminomethyl]-6-phenylphenol (PubChem CID 137069260) has the molecular formula C40H46N2O2 and a molecular weight of 586.82 g/mol. Its IUPAC name is 4-tert-butyl-2-[[2-[(5-tert-butyl-2-hydroxy-3-phenylphenyl)methylideneamino]cyclohexyl]iminomethyl]-6-phenylphenol.
| Compound Name | 4-tert-butyl-2-[[2-[(5-tert-butyl-2-hydroxy-3-phenylphenyl)methylideneamino]cyclohexyl]iminomethyl]-6-phenylphenol |
|---|---|
| PubChem CID | 137069260 |
| Molecular Formula | C40H46N2O2 |
| Molecular Weight | 586.82 g/mol |
| Exact Mass | 586.36 |
| IUPAC Name | 4-tert-butyl-2-[[2-[(5-tert-butyl-2-hydroxy-3-phenylphenyl)methylideneamino]cyclohexyl]iminomethyl]-6-phenylphenol |
| SMILES | CC(C)(C)c1cc(/C=N\C2CCCCC2/N=C/c2cc(C(C)(C)C)cc(-c3ccccc3)c2O)c(O)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C40H46N2O2/c1-39(2,3)31-21-29(37(43)33(23-31)27-15-9-7-10-16-27)25-41-35-19-13-14-20-36(35)42-26-30-22-32(40(4,5)6)24-34(38(30)44)28-17-11-8-12-18-28/h7-12,15-18,21-26,35-36,43-44H,13-14,19-20H2,1-6H3/b41-25-,42-26+ |
| InChIKey | JEACZQMGNWFAEZ-LTEVTRLRSA-N |
| XLogP | 9.88 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.82 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|