C29H37F3N2O2 — CID 136870308
2,4-ditert-butyl-6-[[(1R,2R)-2-[[2-hydroxy-3-(trifluoromethyl)phenyl]methylideneamino]cyclohexyl]iminomethyl]phenol (PubChem CID 136870308) has the molecular formula C29H37F3N2O2 and a molecular weight of 502.62 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[[(1R,2R)-2-[[2-hydroxy-3-(trifluoromethyl)phenyl]methylideneamino]cyclohexyl]iminomethyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[[(1R,2R)-2-[[2-hydroxy-3-(trifluoromethyl)phenyl]methylideneamino]cyclohexyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 136870308 |
| Molecular Formula | C29H37F3N2O2 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | 2,4-ditert-butyl-6-[[(1R,2R)-2-[[2-hydroxy-3-(trifluoromethyl)phenyl]methylideneamino]cyclohexyl]iminomethyl]phenol |
| SMILES | CC(C)(C)c1cc(/C=N/[C@@H]2CCCC[C@H]2/N=C/c2cccc(C(F)(F)F)c2O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C29H37F3N2O2/c1-27(2,3)20-14-19(26(36)22(15-20)28(4,5)6)17-34-24-13-8-7-12-23(24)33-16-18-10-9-11-21(25(18)35)29(30,31)32/h9-11,14-17,23-24,35-36H,7-8,12-13H2,1-6H3/b33-16+,34-17+/t23-,24-/m1/s1 |
| InChIKey | PFFGUIZXGYXOSB-SOLAMGGMSA-N |
| XLogP | 7.56 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|