C28H38N2O4 — CID 137125280
2-[[(1S,2S)-2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]benzene-1,3,5-triol (PubChem CID 137125280) has the molecular formula C28H38N2O4 and a molecular weight of 466.62 g/mol. Its IUPAC name is 2-[[(1S,2S)-2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]benzene-1,3,5-triol.
| Compound Name | 2-[[(1S,2S)-2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]benzene-1,3,5-triol |
|---|---|
| PubChem CID | 137125280 |
| Molecular Formula | C28H38N2O4 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | 2-[[(1S,2S)-2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]benzene-1,3,5-triol |
| SMILES | CC(C)(C)c1cc(/C=N/[C@H]2CCCC[C@@H]2/N=C/c2c(O)cc(O)cc2O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C28H38N2O4/c1-27(2,3)18-11-17(26(34)21(12-18)28(4,5)6)15-29-22-9-7-8-10-23(22)30-16-20-24(32)13-19(31)14-25(20)33/h11-16,22-23,31-34H,7-10H2,1-6H3/b29-15+,30-16+/t22-,23-/m0/s1 |
| InChIKey | ZIOWRIFQTMQJMS-MHVUWFQRSA-N |
| XLogP | 5.95 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|