C34H37NO — CID 136694058
2,4-bis(2-phenylpropan-2-yl)-6-[(2-propan-2-ylphenyl)iminomethyl]phenol (PubChem CID 136694058) has the molecular formula C34H37NO and a molecular weight of 475.68 g/mol. Its IUPAC name is 2,4-bis(2-phenylpropan-2-yl)-6-[(2-propan-2-ylphenyl)iminomethyl]phenol.
| Compound Name | 2,4-bis(2-phenylpropan-2-yl)-6-[(2-propan-2-ylphenyl)iminomethyl]phenol |
|---|---|
| PubChem CID | 136694058 |
| Molecular Formula | C34H37NO |
| Molecular Weight | 475.68 g/mol |
| Exact Mass | 475.29 |
| IUPAC Name | 2,4-bis(2-phenylpropan-2-yl)-6-[(2-propan-2-ylphenyl)iminomethyl]phenol |
| SMILES | CC(C)c1ccccc1/N=C/c1cc(C(C)(C)c2ccccc2)cc(C(C)(C)c2ccccc2)c1O |
| InChI | InChI=1S/C34H37NO/c1-24(2)29-19-13-14-20-31(29)35-23-25-21-28(33(3,4)26-15-9-7-10-16-26)22-30(32(25)36)34(5,6)27-17-11-8-12-18-27/h7-24,36H,1-6H3/b35-23+ |
| InChIKey | IOXWVRWPMOFUNK-QCFMCPCVSA-N |
| XLogP | 8.92 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.68 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|