C37H45NO — CID 137234439
2-[1-(1-adamantyl)ethyliminomethyl]-4,6-bis(2-phenylpropan-2-yl)phenol (PubChem CID 137234439) has the molecular formula C37H45NO and a molecular weight of 519.77 g/mol. Its IUPAC name is 2-[1-(1-adamantyl)ethyliminomethyl]-4,6-bis(2-phenylpropan-2-yl)phenol.
| Compound Name | 2-[1-(1-adamantyl)ethyliminomethyl]-4,6-bis(2-phenylpropan-2-yl)phenol |
|---|---|
| PubChem CID | 137234439 |
| Molecular Formula | C37H45NO |
| Molecular Weight | 519.77 g/mol |
| Exact Mass | 519.35 |
| IUPAC Name | 2-[1-(1-adamantyl)ethyliminomethyl]-4,6-bis(2-phenylpropan-2-yl)phenol |
| SMILES | CC(/N=C/c1cc(C(C)(C)c2ccccc2)cc(C(C)(C)c2ccccc2)c1O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C37H45NO/c1-25(37-21-26-16-27(22-37)18-28(17-26)23-37)38-24-29-19-32(35(2,3)30-12-8-6-9-13-30)20-33(34(29)39)36(4,5)31-14-10-7-11-15-31/h6-15,19-20,24-28,39H,16-18,21-23H2,1-5H3/b38-24+ |
| InChIKey | NSAFAMMQNZTHST-RQXXSLPSSA-N |
| XLogP | 9.07 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.77 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|