C22H25NO2 — CID 136780704
2-[[(1S)-1-(1-adamantyl)ethyl]iminomethyl]-3-hydroxyinden-1-one (PubChem CID 136780704) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 2-[[(1S)-1-(1-adamantyl)ethyl]iminomethyl]-3-hydroxyinden-1-one.
| Compound Name | 2-[[(1S)-1-(1-adamantyl)ethyl]iminomethyl]-3-hydroxyinden-1-one |
|---|---|
| PubChem CID | 136780704 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 2-[[(1S)-1-(1-adamantyl)ethyl]iminomethyl]-3-hydroxyinden-1-one |
| SMILES | C[C@H](/N=C/C1=C(O)c2ccccc2C1=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H25NO2/c1-13(22-9-14-6-15(10-22)8-16(7-14)11-22)23-12-19-20(24)17-4-2-3-5-18(17)21(19)25/h2-5,12-16,24H,6-11H2,1H3/b23-12+/t13-,14?,15?,16?,22?/m0/s1 |
| InChIKey | SOVXQANXGDDZFK-MPJMGTAGSA-N |
| XLogP | 4.83 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_C(7)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|