C13H10O3 — CID 21160878
4-hydroxy-3-[(Z)-prop-1-enyl]naphthalene-1,2-dione (PubChem CID 21160878) has the molecular formula C13H10O3 and a molecular weight of 214.22 g/mol. Its IUPAC name is 4-hydroxy-3-[(Z)-prop-1-enyl]naphthalene-1,2-dione.
| Compound Name | 4-hydroxy-3-[(Z)-prop-1-enyl]naphthalene-1,2-dione |
|---|---|
| PubChem CID | 21160878 |
| Molecular Formula | C13H10O3 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 4-hydroxy-3-[(Z)-prop-1-enyl]naphthalene-1,2-dione |
| SMILES | C/C=C\C1=C(O)c2ccccc2C(=O)C1=O |
| InChI | InChI=1S/C13H10O3/c1-2-5-10-11(14)8-6-3-4-7-9(8)12(15)13(10)16/h2-7,14H,1H3/b5-2- |
| InChIKey | MFNVTOPBJXIFMN-DJWKRKHSSA-N |
| XLogP | 2.30 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|