C13H10O2 — CID 139241161
2-[(E)-prop-1-enyl]naphthalene-1,4-dione (PubChem CID 139241161) has the molecular formula C13H10O2 and a molecular weight of 198.22 g/mol. Its IUPAC name is 2-[(E)-prop-1-enyl]naphthalene-1,4-dione.
| Compound Name | 2-[(E)-prop-1-enyl]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 139241161 |
| Molecular Formula | C13H10O2 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 2-[(E)-prop-1-enyl]naphthalene-1,4-dione |
| SMILES | C/C=C/C1=CC(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H10O2/c1-2-5-9-8-12(14)10-6-3-4-7-11(10)13(9)15/h2-8H,1H3/b5-2+ |
| InChIKey | ILBQCIGZZCDRAA-GORDUTHDSA-N |
| XLogP | 2.57 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|