C14H12O3 — CID 92532873
2-[(Z,1S)-1-hydroxybut-2-enyl]naphthalene-1,4-dione (PubChem CID 92532873) has the molecular formula C14H12O3 and a molecular weight of 228.25 g/mol. Its IUPAC name is 2-[(Z,1S)-1-hydroxybut-2-enyl]naphthalene-1,4-dione.
| Compound Name | 2-[(Z,1S)-1-hydroxybut-2-enyl]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 92532873 |
| Molecular Formula | C14H12O3 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 2-[(Z,1S)-1-hydroxybut-2-enyl]naphthalene-1,4-dione |
| SMILES | C/C=C\[C@H](O)C1=CC(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C14H12O3/c1-2-5-12(15)11-8-13(16)9-6-3-4-7-10(9)14(11)17/h2-8,12,15H,1H3/b5-2-/t12-/m0/s1 |
| InChIKey | ZPAOUSLIGLNAHF-PZBKNZOISA-N |
| XLogP | 1.93 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|