C10H9NO5S — CID 131881245
azane;1,4-dioxonaphthalene-2-sulfonic acid (PubChem CID 131881245) has the molecular formula C10H9NO5S and a molecular weight of 255.25 g/mol. Its IUPAC name is azane;1,4-dioxonaphthalene-2-sulfonic acid.
| Compound Name | azane;1,4-dioxonaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 131881245 |
| Molecular Formula | C10H9NO5S |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.02 |
| IUPAC Name | azane;1,4-dioxonaphthalene-2-sulfonic acid |
| SMILES | N.O=C1C=C(S(=O)(=O)O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C10H6O5S.H3N/c11-8-5-9(16(13,14)15)10(12)7-4-2-1-3-6(7)8;/h1-5H,(H,13,14,15);1H3 |
| InChIKey | NXKJPCDZJAZKRM-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 123.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|