C10H7NaO5S — CID 173009524
sodium;1,4-dioxonaphthalene-2-sulfonic acid;hydride (PubChem CID 173009524) has the molecular formula C10H7NaO5S and a molecular weight of 262.22 g/mol. Its IUPAC name is sodium;1,4-dioxonaphthalene-2-sulfonic acid;hydride.
| Compound Name | sodium;1,4-dioxonaphthalene-2-sulfonic acid;hydride |
|---|---|
| PubChem CID | 173009524 |
| Molecular Formula | C10H7NaO5S |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 261.99 |
| IUPAC Name | sodium;1,4-dioxonaphthalene-2-sulfonic acid;hydride |
| SMILES | O=C1C=C(S(=O)(=O)O)C(=O)c2ccccc21.[H-].[Na+] |
| InChI | InChI=1S/C10H6O5S.Na.H/c11-8-5-9(16(13,14)15)10(12)7-4-2-1-3-6(7)8;;/h1-5H,(H,13,14,15);;/q;+1;-1 |
| InChIKey | UXLNIYUASNJZBR-UHFFFAOYSA-N |
| XLogP | -2.05 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|