C14H14O4S — CID 139943389
2-(2-methylpropylsulfonyl)naphthalene-1,4-dione (PubChem CID 139943389) has the molecular formula C14H14O4S and a molecular weight of 278.33 g/mol. Its IUPAC name is 2-(2-methylpropylsulfonyl)naphthalene-1,4-dione.
| Compound Name | 2-(2-methylpropylsulfonyl)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 139943389 |
| Molecular Formula | C14H14O4S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 2-(2-methylpropylsulfonyl)naphthalene-1,4-dione |
| SMILES | CC(C)CS(=O)(=O)C1=CC(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C14H14O4S/c1-9(2)8-19(17,18)13-7-12(15)10-5-3-4-6-11(10)14(13)16/h3-7,9H,8H2,1-2H3 |
| InChIKey | RVBQBIHBVFBKRJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|